C9H8Cl2N2O — CID 130987877
(3S)-3-amino-3-(4,5-dichloro-2-hydroxyphenyl)propanenitrile (PubChem CID 130987877) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is (3S)-3-amino-3-(4,5-dichloro-2-hydroxyphenyl)propanenitrile.
| Compound Name | (3S)-3-amino-3-(4,5-dichloro-2-hydroxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 130987877 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | (3S)-3-amino-3-(4,5-dichloro-2-hydroxyphenyl)propanenitrile |
| SMILES | N#CC[C@H](N)c1cc(Cl)c(Cl)cc1O |
| InChI | InChI=1S/C9H8Cl2N2O/c10-6-3-5(8(13)1-2-12)9(14)4-7(6)11/h3-4,8,14H,1,13H2/t8-/m0/s1 |
| InChIKey | LLISBKFCZWRRNY-QMMMGPOBSA-N |
| XLogP | 2.61 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|