C10H12N2O — CID 55282888
3-amino-3-(5-hydroxy-2-methylphenyl)propanenitrile (PubChem CID 55282888) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-amino-3-(5-hydroxy-2-methylphenyl)propanenitrile.
| Compound Name | 3-amino-3-(5-hydroxy-2-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 55282888 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-amino-3-(5-hydroxy-2-methylphenyl)propanenitrile |
| SMILES | Cc1ccc(O)cc1C(N)CC#N |
| InChI | InChI=1S/C10H12N2O/c1-7-2-3-8(13)6-9(7)10(12)4-5-11/h2-3,6,10,13H,4,12H2,1H3 |
| InChIKey | SUSPTOBZHCLHOR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |