C9H12N2O — CID 131082143
(3S)-3-amino-3-(4,5-dimethylfuran-2-yl)propanenitrile (PubChem CID 131082143) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is (3S)-3-amino-3-(4,5-dimethylfuran-2-yl)propanenitrile.
| Compound Name | (3S)-3-amino-3-(4,5-dimethylfuran-2-yl)propanenitrile |
|---|---|
| PubChem CID | 131082143 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (3S)-3-amino-3-(4,5-dimethylfuran-2-yl)propanenitrile |
| SMILES | Cc1cc([C@@H](N)CC#N)oc1C |
| InChI | InChI=1S/C9H12N2O/c1-6-5-9(12-7(6)2)8(11)3-4-10/h5,8H,3,11H2,1-2H3/t8-/m0/s1 |
| InChIKey | PJJDJMCZUNKLIA-QMMMGPOBSA-N |
| XLogP | 1.81 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |