C9H15NO — CID 55275935
(1R)-1-(4,5-dimethylfuran-2-yl)propan-1-amine (PubChem CID 55275935) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethylfuran-2-yl)propan-1-amine.
| Compound Name | (1R)-1-(4,5-dimethylfuran-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 55275935 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (1R)-1-(4,5-dimethylfuran-2-yl)propan-1-amine |
| SMILES | CC[C@@H](N)c1cc(C)c(C)o1 |
| InChI | InChI=1S/C9H15NO/c1-4-8(10)9-5-6(2)7(3)11-9/h5,8H,4,10H2,1-3H3/t8-/m1/s1 |
| InChIKey | SXZZESSKPJDGKA-MRVPVSSYSA-N |
| XLogP | 2.31 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |