About 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine
3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine (PubChem CID 114248905) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine |
| PubChem CID | 114248905 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine |
| SMILES | Cc1cc(C(N)CCC2CCCCC2)oc1C |
| InChI | InChI=1S/C15H25NO/c1-11-10-15(17-12(11)2)14(16)9-8-13-6-4-3-5-7-13/h10,13-14H,3-9,16H2,1-2H3 |
| InChIKey | BSQQTAMSPXRUDS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine?
The IUPAC name of 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine (CID 114248905) is 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine.
What is the SMILES notation for 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine?
The canonical SMILES for 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine is Cc1cc(C(N)CCC2CCCCC2)oc1C.
What is the InChIKey of 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine?
The InChIKey is BSQQTAMSPXRUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-11-10-15(17-12(11)2)14(16)9-8-13-6-4-3-5-7-13/h10,13-14H,3-9,16H2,1-2H3.
What are the key properties of 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine?
3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine has a molecular weight of 235.37 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-(4,5-dimethylfuran-2-yl)propan-1-amine is sourced from PubChem (CID 114248905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).