C16H26N2 — CID 114269362
3-cyclohexyl-1-(4,6-dimethyl-2-pyridinyl)propan-1-amine (PubChem CID 114269362) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 3-cyclohexyl-1-(4,6-dimethyl-2-pyridinyl)propan-1-amine.
| Compound Name | 3-cyclohexyl-1-(4,6-dimethyl-2-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 114269362 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3-cyclohexyl-1-(4,6-dimethyl-2-pyridinyl)propan-1-amine |
| SMILES | Cc1cc(C)nc(C(N)CCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H26N2/c1-12-10-13(2)18-16(11-12)15(17)9-8-14-6-4-3-5-7-14/h10-11,14-15H,3-9,17H2,1-2H3 |
| InChIKey | UWIIUXKXOYBPAM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |