C9H16N2O — CID 130804019
(1R,2S)-1-(4,5-dimethylfuran-2-yl)propane-1,2-diamine (PubChem CID 130804019) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (1R,2S)-1-(4,5-dimethylfuran-2-yl)propane-1,2-diamine.
| Compound Name | (1R,2S)-1-(4,5-dimethylfuran-2-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 130804019 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (1R,2S)-1-(4,5-dimethylfuran-2-yl)propane-1,2-diamine |
| SMILES | Cc1cc([C@H](N)[C@H](C)N)oc1C |
| InChI | InChI=1S/C9H16N2O/c1-5-4-8(12-7(5)3)9(11)6(2)10/h4,6,9H,10-11H2,1-3H3/t6-,9+/m0/s1 |
| InChIKey | XLLQNNVRMJDPLM-IMTBSYHQSA-N |
| XLogP | 1.24 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |