About 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal
4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal (PubChem CID 174729534) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal.
Molecular Properties
| Compound Name | 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal |
| PubChem CID | 174729534 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal |
| SMILES | Cc1cc(C(N)C(C)CC=O)oc1C |
| InChI | InChI=1S/C11H17NO2/c1-7(4-5-13)11(12)10-6-8(2)9(3)14-10/h5-7,11H,4,12H2,1-3H3 |
| InChIKey | BAHIKOYDNYZUEW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal?
The IUPAC name of 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal (CID 174729534) is 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal.
What is the SMILES notation for 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal?
The canonical SMILES for 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal is Cc1cc(C(N)C(C)CC=O)oc1C.
What is the InChIKey of 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal?
The InChIKey is BAHIKOYDNYZUEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-7(4-5-13)11(12)10-6-8(2)9(3)14-10/h5-7,11H,4,12H2,1-3H3.
What are the key properties of 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal?
4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal has a molecular weight of 195.26 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-(4,5-dimethylfuran-2-yl)-3-methylbutanal is sourced from PubChem (CID 174729534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).