C11H21NO — CID 142883277
(4,5-dimethylfuran-2-yl)methanamine;2-methylpropane (PubChem CID 142883277) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (4,5-dimethylfuran-2-yl)methanamine;2-methylpropane.
| Compound Name | (4,5-dimethylfuran-2-yl)methanamine;2-methylpropane |
|---|---|
| PubChem CID | 142883277 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (4,5-dimethylfuran-2-yl)methanamine;2-methylpropane |
| SMILES | CC(C)C.Cc1cc(CN)oc1C |
| InChI | InChI=1S/C7H11NO.C4H10/c1-5-3-7(4-8)9-6(5)2;1-4(2)3/h3H,4,8H2,1-2H3;4H,1-3H3 |
| InChIKey | GWCWPSKFBJNKGC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |