About (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride
(1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride (PubChem CID 171213830) has the molecular formula C8H14ClNO
and a molecular weight of 175.66 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride |
| PubChem CID | 171213830 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride |
| SMILES | Cc1cc([C@@H](C)N)oc1C.Cl |
| InChI | InChI=1S/C8H13NO.ClH/c1-5-4-8(6(2)9)10-7(5)3;/h4,6H,9H2,1-3H3;1H/t6-;/m1./s1 |
| InChIKey | ZYNTVWMHKGNLDQ-FYZOBXCZSA-N |
| XLogP | 2.34 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride?
The IUPAC name of (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride (CID 171213830) is (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride.
What is the SMILES notation for (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride?
The canonical SMILES for (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride is Cc1cc([C@@H](C)N)oc1C.Cl.
What is the InChIKey of (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride?
The InChIKey is ZYNTVWMHKGNLDQ-FYZOBXCZSA-N. The full InChI is InChI=1S/C8H13NO.ClH/c1-5-4-8(6(2)9)10-7(5)3;/h4,6H,9H2,1-3H3;1H/t6-;/m1./s1.
What are the key properties of (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride?
(1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride has a molecular weight of 175.66 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(4,5-dimethylfuran-2-yl)ethanamine;hydrochloride is sourced from PubChem (CID 171213830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).