C11H13NO2 — CID 130495135
(4,5-dimethylfuran-2-yl)-(furan-2-yl)methanamine (PubChem CID 130495135) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (4,5-dimethylfuran-2-yl)-(furan-2-yl)methanamine.
| Compound Name | (4,5-dimethylfuran-2-yl)-(furan-2-yl)methanamine |
|---|---|
| PubChem CID | 130495135 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (4,5-dimethylfuran-2-yl)-(furan-2-yl)methanamine |
| SMILES | Cc1cc(C(N)c2ccco2)oc1C |
| InChI | InChI=1S/C11H13NO2/c1-7-6-10(14-8(7)2)11(12)9-4-3-5-13-9/h3-6,11H,12H2,1-2H3 |
| InChIKey | UJRBTZIVGHBIBU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |