About furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine
furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine (PubChem CID 55269817) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine.
Analyze furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine?
The IUPAC name of furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine (CID 55269817) is furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine.
What is the SMILES notation for furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine?
The canonical SMILES for furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine is Cc1nnc(C(N)c2ccco2)o1.
What is the InChIKey of furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine?
The InChIKey is AJRMHORRSNERIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-5-10-11-8(13-5)7(9)6-3-2-4-12-6/h2-4,7H,9H2,1H3.
What are the key properties of furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine?
furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine has a molecular weight of 179.18 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-yl-(5-methyl-1,3,4-oxadiazol-2-yl)methanamine is sourced from PubChem (CID 55269817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).