C13H15NO — CID 51690800
(S)-(2,4-dimethylphenyl)-(furan-2-yl)methanamine (PubChem CID 51690800) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (S)-(2,4-dimethylphenyl)-(furan-2-yl)methanamine.
| Compound Name | (S)-(2,4-dimethylphenyl)-(furan-2-yl)methanamine |
|---|---|
| PubChem CID | 51690800 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (S)-(2,4-dimethylphenyl)-(furan-2-yl)methanamine |
| SMILES | Cc1ccc([C@H](N)c2ccco2)c(C)c1 |
| InChI | InChI=1S/C13H15NO/c1-9-5-6-11(10(2)8-9)13(14)12-4-3-7-15-12/h3-8,13H,14H2,1-2H3/t13-/m0/s1 |
| InChIKey | WPJAAUMYHLQNOL-ZDUSSCGKSA-N |
| XLogP | 2.94 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |