C13H12F3NO — CID 102753944
furan-2-yl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 102753944) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is furan-2-yl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | furan-2-yl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102753944 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | furan-2-yl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(N)c1ccco1 |
| InChI | InChI=1S/C13H12F3NO/c1-8-7-9(13(14,15)16)4-5-10(8)12(17)11-3-2-6-18-11/h2-7,12H,17H2,1H3 |
| InChIKey | KVHGLWBKTGQHRJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |