C11H8F3NO — CID 103301909
furan-2-yl-(2,4,5-trifluorophenyl)methanamine (PubChem CID 103301909) has the molecular formula C11H8F3NO and a molecular weight of 227.19 g/mol. Its IUPAC name is furan-2-yl-(2,4,5-trifluorophenyl)methanamine.
| Compound Name | furan-2-yl-(2,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 103301909 |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | furan-2-yl-(2,4,5-trifluorophenyl)methanamine |
| SMILES | NC(c1ccco1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H8F3NO/c12-7-5-9(14)8(13)4-6(7)11(15)10-2-1-3-16-10/h1-5,11H,15H2 |
| InChIKey | UKGDYCLQQKVPSM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|