C11H9F2NO — CID 43415092
(2,5-difluorophenyl)-(furan-2-yl)methanamine (PubChem CID 43415092) has the molecular formula C11H9F2NO and a molecular weight of 209.20 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(furan-2-yl)methanamine.
| Compound Name | (2,5-difluorophenyl)-(furan-2-yl)methanamine |
|---|---|
| PubChem CID | 43415092 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2,5-difluorophenyl)-(furan-2-yl)methanamine |
| SMILES | NC(c1ccco1)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H9F2NO/c12-7-3-4-9(13)8(6-7)11(14)10-2-1-5-15-10/h1-6,11H,14H2 |
| InChIKey | IJSVVIRXOZMQLB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |