C11H10F2N2O — CID 105213547
[(2,5-difluorophenyl)-(furan-2-yl)methyl]hydrazine (PubChem CID 105213547) has the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. Its IUPAC name is [(2,5-difluorophenyl)-(furan-2-yl)methyl]hydrazine.
| Compound Name | [(2,5-difluorophenyl)-(furan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105213547 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [(2,5-difluorophenyl)-(furan-2-yl)methyl]hydrazine |
| SMILES | NNC(c1ccco1)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H10F2N2O/c12-7-3-4-9(13)8(6-7)11(15-14)10-2-1-5-16-10/h1-6,11,15H,14H2 |
| InChIKey | PVTFAFQSWAHVGI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|