C15H16ClF3N2O — CID 171177233
1-[(S)-furan-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine;hydrochloride (PubChem CID 171177233) has the molecular formula C15H16ClF3N2O and a molecular weight of 332.75 g/mol. Its IUPAC name is 1-[(S)-furan-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-furan-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171177233 |
| Molecular Formula | C15H16ClF3N2O |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[(S)-furan-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1cc(F)c([C@@H](c2ccco2)N2CCNCC2)cc1F |
| InChI | InChI=1S/C15H15F3N2O.ClH/c16-11-9-13(18)12(17)8-10(11)15(14-2-1-7-21-14)20-5-3-19-4-6-20;/h1-2,7-9,15,19H,3-6H2;1H/t15-;/m0./s1 |
| InChIKey | NUFYRJKLKMQLTK-RSAXXLAASA-N |
| XLogP | 3.11 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|