C15H18ClFN2O2 — CID 171175035
4-fluoro-2-[(S)-furan-2-yl(piperazin-1-yl)methyl]phenol;hydrochloride (PubChem CID 171175035) has the molecular formula C15H18ClFN2O2 and a molecular weight of 312.77 g/mol. Its IUPAC name is 4-fluoro-2-[(S)-furan-2-yl(piperazin-1-yl)methyl]phenol;hydrochloride.
| Compound Name | 4-fluoro-2-[(S)-furan-2-yl(piperazin-1-yl)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171175035 |
| Molecular Formula | C15H18ClFN2O2 |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-fluoro-2-[(S)-furan-2-yl(piperazin-1-yl)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(F)cc1[C@@H](c1ccco1)N1CCNCC1 |
| InChI | InChI=1S/C15H17FN2O2.ClH/c16-11-3-4-13(19)12(10-11)15(14-2-1-9-20-14)18-7-5-17-6-8-18;/h1-4,9-10,15,17,19H,5-8H2;1H/t15-;/m0./s1 |
| InChIKey | ZKRIZVZLXRGNJC-RSAXXLAASA-N |
| XLogP | 2.54 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|