C16H18F2N2O2 — CID 171177505
1-[(S)-[2-(difluoromethoxy)phenyl]-(furan-2-yl)methyl]piperazine (PubChem CID 171177505) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-[(S)-[2-(difluoromethoxy)phenyl]-(furan-2-yl)methyl]piperazine.
| Compound Name | 1-[(S)-[2-(difluoromethoxy)phenyl]-(furan-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171177505 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[(S)-[2-(difluoromethoxy)phenyl]-(furan-2-yl)methyl]piperazine |
| SMILES | FC(F)Oc1ccccc1[C@@H](c1ccco1)N1CCNCC1 |
| InChI | InChI=1S/C16H18F2N2O2/c17-16(18)22-13-5-2-1-4-12(13)15(14-6-3-11-21-14)20-9-7-19-8-10-20/h1-6,11,15-16,19H,7-10H2/t15-/m0/s1 |
| InChIKey | OAWLZCXWTFVMQX-HNNXBMFYSA-N |
| XLogP | 2.88 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |