C17H19F3N2O3 — CID 171180282
1-[(R)-furan-2-yl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171180282) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 1-[(R)-furan-2-yl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-furan-2-yl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171180282 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(R)-furan-2-yl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | COc1ccc(OC(F)(F)F)cc1[C@H](c1ccco1)N1CCNCC1 |
| InChI | InChI=1S/C17H19F3N2O3/c1-23-14-5-4-12(25-17(18,19)20)11-13(14)16(15-3-2-10-24-15)22-8-6-21-7-9-22/h2-5,10-11,16,21H,6-9H2,1H3/t16-/m1/s1 |
| InChIKey | NVQHIOXDGISCPT-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |