C19H23Cl2F3N2O2 — CID 171286916
1-[(R)-(2-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171286916) has the molecular formula C19H23Cl2F3N2O2 and a molecular weight of 439.31 g/mol. Its IUPAC name is 1-[(R)-(2-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(2-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171286916 |
| Molecular Formula | C19H23Cl2F3N2O2 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-[(R)-(2-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | COc1ccccc1[C@@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H21F3N2O2.2ClH/c1-25-17-5-3-2-4-16(17)18(24-12-10-23-11-13-24)14-6-8-15(9-7-14)26-19(20,21)22;;/h2-9,18,23H,10-13H2,1H3;2*1H/t18-;;/m1../s1 |
| InChIKey | JTPQSAREHKFWPJ-JPKZNVRTSA-N |
| XLogP | 4.43 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |