C20H23F3N2O — CID 171275817
1-[(S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171275817) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-[(S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171275817 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-[(S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | Cc1cccc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c1C |
| InChI | InChI=1S/C20H23F3N2O/c1-14-4-3-5-18(15(14)2)19(25-12-10-24-11-13-25)16-6-8-17(9-7-16)26-20(21,22)23/h3-9,19,24H,10-13H2,1-2H3/t19-/m0/s1 |
| InChIKey | GXIHPMIQKGMIOY-IBGZPJMESA-N |
| XLogP | 4.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |