C18H18F4N2O2 — CID 171285713
2-fluoro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol (PubChem CID 171285713) has the molecular formula C18H18F4N2O2 and a molecular weight of 370.35 g/mol. Its IUPAC name is 2-fluoro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol.
| Compound Name | 2-fluoro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 171285713 |
| Molecular Formula | C18H18F4N2O2 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-fluoro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
| SMILES | Oc1c(F)cccc1[C@@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H18F4N2O2/c19-15-3-1-2-14(17(15)25)16(24-10-8-23-9-11-24)12-4-6-13(7-5-12)26-18(20,21)22/h1-7,16,23,25H,8-11H2/t16-/m1/s1 |
| InChIKey | GYUXPVCKHQXVOT-MRXNPFEDSA-N |
| XLogP | 3.42 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|