C18H19F4N3O2 — CID 171298501
2-amino-3-fluoro-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol (PubChem CID 171298501) has the molecular formula C18H19F4N3O2 and a molecular weight of 385.36 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol.
| Compound Name | 2-amino-3-fluoro-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 171298501 |
| Molecular Formula | C18H19F4N3O2 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-amino-3-fluoro-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
| SMILES | Nc1c(F)ccc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c1O |
| InChI | InChI=1S/C18H19F4N3O2/c19-14-6-5-13(17(26)15(14)23)16(25-9-7-24-8-10-25)11-1-3-12(4-2-11)27-18(20,21)22/h1-6,16,24,26H,7-10,23H2/t16-/m0/s1 |
| InChIKey | ITYXTCNMOWFPMZ-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|