C19H20F4N2O2 — CID 171286633
1-[(R)-(2-fluoro-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171286633) has the molecular formula C19H20F4N2O2 and a molecular weight of 384.37 g/mol. Its IUPAC name is 1-[(R)-(2-fluoro-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-(2-fluoro-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171286633 |
| Molecular Formula | C19H20F4N2O2 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[(R)-(2-fluoro-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | COc1ccc([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C19H20F4N2O2/c1-26-15-6-7-16(17(20)12-15)18(25-10-8-24-9-11-25)13-2-4-14(5-3-13)27-19(21,22)23/h2-7,12,18,24H,8-11H2,1H3/t18-/m1/s1 |
| InChIKey | JOYHWSSMGTUTRP-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |