C20H23F3N2O3 — CID 171287396
1-[(R)-(2,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171287396) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-[(R)-(2,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-(2,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171287396 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[(R)-(2,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | COc1ccc([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C20H23F3N2O3/c1-26-16-7-8-17(18(13-16)27-2)19(25-11-9-24-10-12-25)14-3-5-15(6-4-14)28-20(21,22)23/h3-8,13,19,24H,9-12H2,1-2H3/t19-/m1/s1 |
| InChIKey | CNMPIIBQNKPRBS-LJQANCHMSA-N |
| XLogP | 3.60 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |