C20H23F3N2O2 — CID 3817195
1-[(2,4-dimethoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 3817195) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 3817195 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | COc1ccc(C(c2cccc(C(F)(F)F)c2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-26-16-6-7-17(18(13-16)27-2)19(25-10-8-24-9-11-25)14-4-3-5-15(12-14)20(21,22)23/h3-7,12-13,19,24H,8-11H2,1-2H3 |
| InChIKey | MBFFAMVVEJNJRP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |