C21H22F3N3O2 — CID 171273749
5-methoxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole (PubChem CID 171273749) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 5-methoxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole.
| Compound Name | 5-methoxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole |
|---|---|
| PubChem CID | 171273749 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 5-methoxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole |
| SMILES | COc1ccc2[nH]cc([C@H](c3ccc(OC(F)(F)F)cc3)N3CCNCC3)c2c1 |
| InChI | InChI=1S/C21H22F3N3O2/c1-28-16-6-7-19-17(12-16)18(13-26-19)20(27-10-8-25-9-11-27)14-2-4-15(5-3-14)29-21(22,23)24/h2-7,12-13,20,25-26H,8-11H2,1H3/t20-/m0/s1 |
| InChIKey | LQPCIJURARSYRU-FQEVSTJZSA-N |
| XLogP | 4.07 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |