C20H22Cl2F3N3O — CID 171285015
3-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole;dihydrochloride (PubChem CID 171285015) has the molecular formula C20H22Cl2F3N3O and a molecular weight of 448.32 g/mol. Its IUPAC name is 3-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole;dihydrochloride.
| Compound Name | 3-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 171285015 |
| Molecular Formula | C20H22Cl2F3N3O |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-1H-indole;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)Oc1ccc([C@H](c2c[nH]c3ccccc23)N2CCNCC2)cc1 |
| InChI | InChI=1S/C20H20F3N3O.2ClH/c21-20(22,23)27-15-7-5-14(6-8-15)19(26-11-9-24-10-12-26)17-13-25-18-4-2-1-3-16(17)18;;/h1-8,13,19,24-25H,9-12H2;2*1H/t19-;;/m1../s1 |
| InChIKey | KVVQGYZRUXAFTQ-JQDLGSOUSA-N |
| XLogP | 4.90 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |