C18H20Cl2F3N3O3 — CID 171272639
1-[(S)-(2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171272639) has the molecular formula C18H20Cl2F3N3O3 and a molecular weight of 454.28 g/mol. Its IUPAC name is 1-[(S)-(2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171272639 |
| Molecular Formula | C18H20Cl2F3N3O3 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 1-[(S)-(2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccccc1[C@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H18F3N3O3.2ClH/c19-18(20,21)27-14-7-5-13(6-8-14)17(23-11-9-22-10-12-23)15-3-1-2-4-16(15)24(25)26;;/h1-8,17,22H,9-12H2;2*1H/t17-;;/m0../s1 |
| InChIKey | AWSWCSUFTAAOOG-RMRYJAPISA-N |
| XLogP | 4.33 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|