C19H22Cl2F3N3O4 — CID 171301661
3-methyl-2-nitro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride (PubChem CID 171301661) has the molecular formula C19H22Cl2F3N3O4 and a molecular weight of 484.30 g/mol. Its IUPAC name is 3-methyl-2-nitro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride.
| Compound Name | 3-methyl-2-nitro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171301661 |
| Molecular Formula | C19H22Cl2F3N3O4 |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 3-methyl-2-nitro-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride |
| SMILES | Cc1ccc([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c(O)c1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C19H20F3N3O4.2ClH/c1-12-2-7-15(18(26)16(12)25(27)28)17(24-10-8-23-9-11-24)13-3-5-14(6-4-13)29-19(20,21)22;;/h2-7,17,23,26H,8-11H2,1H3;2*1H/t17-;;/m1../s1 |
| InChIKey | MLORHZZBXOVJGH-ZEECNFPPSA-N |
| XLogP | 4.35 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|