C18H19Cl3F3N3O3 — CID 171278654
1-[(S)-(2-chloro-5-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171278654) has the molecular formula C18H19Cl3F3N3O3 and a molecular weight of 488.72 g/mol. Its IUPAC name is 1-[(S)-(2-chloro-5-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(2-chloro-5-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278654 |
| Molecular Formula | C18H19Cl3F3N3O3 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 1-[(S)-(2-chloro-5-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc(Cl)c([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H17ClF3N3O3.2ClH/c19-16-6-3-13(25(26)27)11-15(16)17(24-9-7-23-8-10-24)12-1-4-14(5-2-12)28-18(20,21)22;;/h1-6,11,17,23H,7-10H2;2*1H/t17-;;/m0../s1 |
| InChIKey | UUCFZTGJNZPKAM-RMRYJAPISA-N |
| XLogP | 4.99 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|