C18H18Cl5F3N2O — CID 171294618
1-[(R)-(2,3,6-trichlorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171294618) has the molecular formula C18H18Cl5F3N2O and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-[(R)-(2,3,6-trichlorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(2,3,6-trichlorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171294618 |
| Molecular Formula | C18H18Cl5F3N2O |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | 1-[(R)-(2,3,6-trichlorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)Oc1ccc([C@H](c2c(Cl)ccc(Cl)c2Cl)N2CCNCC2)cc1 |
| InChI | InChI=1S/C18H16Cl3F3N2O.2ClH/c19-13-5-6-14(20)16(21)15(13)17(26-9-7-25-8-10-26)11-1-3-12(4-2-11)27-18(22,23)24;;/h1-6,17,25H,7-10H2;2*1H/t17-;;/m1../s1 |
| InChIKey | VQLJTXMWWVHOOE-ZEECNFPPSA-N |
| XLogP | 6.38 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|