C19H20ClF3N2O3 — CID 171298621
6-chloro-3-methoxy-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol (PubChem CID 171298621) has the molecular formula C19H20ClF3N2O3 and a molecular weight of 416.83 g/mol. Its IUPAC name is 6-chloro-3-methoxy-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol.
| Compound Name | 6-chloro-3-methoxy-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 171298621 |
| Molecular Formula | C19H20ClF3N2O3 |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 6-chloro-3-methoxy-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
| SMILES | COc1ccc(Cl)c(O)c1[C@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C19H20ClF3N2O3/c1-27-15-7-6-14(20)18(26)16(15)17(25-10-8-24-9-11-25)12-2-4-13(5-3-12)28-19(21,22)23/h2-7,17,24,26H,8-11H2,1H3/t17-/m0/s1 |
| InChIKey | JLCZOFRZPJFEDT-KRWDZBQOSA-N |
| XLogP | 3.95 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|