C19H20BrF3N2O2 — CID 171278079
1-[(S)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171278079) has the molecular formula C19H20BrF3N2O2 and a molecular weight of 445.28 g/mol. Its IUPAC name is 1-[(S)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171278079 |
| Molecular Formula | C19H20BrF3N2O2 |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 1-[(S)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | COc1ccc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)cc1Br |
| InChI | InChI=1S/C19H20BrF3N2O2/c1-26-17-7-4-14(12-16(17)20)18(25-10-8-24-9-11-25)13-2-5-15(6-3-13)27-19(21,22)23/h2-7,12,18,24H,8-11H2,1H3/t18-/m0/s1 |
| InChIKey | ALZCIHPXCXQTCM-SFHVURJKSA-N |
| XLogP | 4.35 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |