C21H25F3N2O3 — CID 171280909
1-[(S)-(3-ethoxy-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171280909) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-[(S)-(3-ethoxy-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-(3-ethoxy-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171280909 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[(S)-(3-ethoxy-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | CCOc1cc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)ccc1OC |
| InChI | InChI=1S/C21H25F3N2O3/c1-3-28-19-14-16(6-9-18(19)27-2)20(26-12-10-25-11-13-26)15-4-7-17(8-5-15)29-21(22,23)24/h4-9,14,20,25H,3,10-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | UFXTZEPIZHPEJH-FQEVSTJZSA-N |
| XLogP | 3.99 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |