C21H25F3N2O4 — CID 171287363
1-[(R)-[4-(trifluoromethoxy)phenyl]-(2,4,6-trimethoxyphenyl)methyl]piperazine (PubChem CID 171287363) has the molecular formula C21H25F3N2O4 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-[(R)-[4-(trifluoromethoxy)phenyl]-(2,4,6-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(R)-[4-(trifluoromethoxy)phenyl]-(2,4,6-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171287363 |
| Molecular Formula | C21H25F3N2O4 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[(R)-[4-(trifluoromethoxy)phenyl]-(2,4,6-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(OC)c([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C21H25F3N2O4/c1-27-16-12-17(28-2)19(18(13-16)29-3)20(26-10-8-25-9-11-26)14-4-6-15(7-5-14)30-21(22,23)24/h4-7,12-13,20,25H,8-11H2,1-3H3/t20-/m1/s1 |
| InChIKey | UJELDOVZJKWRGO-HXUWFJFHSA-N |
| XLogP | 3.61 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |