C18H19Cl3F4N2O2 — CID 171299581
6-chloro-3-fluoro-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride (PubChem CID 171299581) has the molecular formula C18H19Cl3F4N2O2 and a molecular weight of 477.71 g/mol. Its IUPAC name is 6-chloro-3-fluoro-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride.
| Compound Name | 6-chloro-3-fluoro-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171299581 |
| Molecular Formula | C18H19Cl3F4N2O2 |
| Molecular Weight | 477.71 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 6-chloro-3-fluoro-2-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c(Cl)ccc(F)c1[C@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H17ClF4N2O2.2ClH/c19-13-5-6-14(20)15(17(13)26)16(25-9-7-24-8-10-25)11-1-3-12(4-2-11)27-18(21,22)23;;/h1-6,16,24,26H,7-10H2;2*1H/t16-;;/m0../s1 |
| InChIKey | BURUVMWUBVFRKW-SQKCAUCHSA-N |
| XLogP | 4.92 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|