C18H17ClF4N2O — CID 171274068
1-[(S)-(2-chloro-6-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171274068) has the molecular formula C18H17ClF4N2O and a molecular weight of 388.79 g/mol. Its IUPAC name is 1-[(S)-(2-chloro-6-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-(2-chloro-6-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171274068 |
| Molecular Formula | C18H17ClF4N2O |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-[(S)-(2-chloro-6-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | Fc1cccc(Cl)c1[C@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H17ClF4N2O/c19-14-2-1-3-15(20)16(14)17(25-10-8-24-9-11-25)12-4-6-13(7-5-12)26-18(21,22)23/h1-7,17,24H,8-11H2/t17-/m0/s1 |
| InChIKey | SNEIEYPVNOKWCN-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |