C19H20Cl2F3N3O — CID 171288065
2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile;dihydrochloride (PubChem CID 171288065) has the molecular formula C19H20Cl2F3N3O and a molecular weight of 434.29 g/mol. Its IUPAC name is 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile;dihydrochloride.
| Compound Name | 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171288065 |
| Molecular Formula | C19H20Cl2F3N3O |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1ccccc1[C@@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C19H18F3N3O.2ClH/c20-19(21,22)26-16-7-5-14(6-8-16)18(25-11-9-24-10-12-25)17-4-2-1-3-15(17)13-23;;/h1-8,18,24H,9-12H2;2*1H/t18-;;/m1../s1 |
| InChIKey | UYEGBTQTZHBPJR-JPKZNVRTSA-N |
| XLogP | 4.30 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |