C16H23Cl2N3O — CID 171273728
5-methoxy-3-[(1S)-1-piperazin-1-ylprop-2-enyl]-1H-indole;dihydrochloride (PubChem CID 171273728) has the molecular formula C16H23Cl2N3O and a molecular weight of 344.29 g/mol. Its IUPAC name is 5-methoxy-3-[(1S)-1-piperazin-1-ylprop-2-enyl]-1H-indole;dihydrochloride.
| Compound Name | 5-methoxy-3-[(1S)-1-piperazin-1-ylprop-2-enyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 171273728 |
| Molecular Formula | C16H23Cl2N3O |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 5-methoxy-3-[(1S)-1-piperazin-1-ylprop-2-enyl]-1H-indole;dihydrochloride |
| SMILES | C=C[C@@H](c1c[nH]c2ccc(OC)cc12)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H21N3O.2ClH/c1-3-16(19-8-6-17-7-9-19)14-11-18-15-5-4-12(20-2)10-13(14)15;;/h3-5,10-11,16-18H,1,6-9H2,2H3;2*1H/t16-;;/m0../s1 |
| InChIKey | BUXTZQIZIAQARG-SQKCAUCHSA-N |
| XLogP | 3.15 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|