C14H22Cl2N2O2 — CID 171287117
3-methoxy-4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride (PubChem CID 171287117) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-methoxy-4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride.
| Compound Name | 3-methoxy-4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171287117 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-methoxy-4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride |
| SMILES | C=C[C@H](c1ccc(O)cc1OC)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H20N2O2.2ClH/c1-3-13(16-8-6-15-7-9-16)12-5-4-11(17)10-14(12)18-2;;/h3-5,10,13,15,17H,1,6-9H2,2H3;2*1H/t13-;;/m1../s1 |
| InChIKey | KHOSVSGVJWXEQA-FFXKMJQXSA-N |
| XLogP | 2.38 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|