C14H20Br2Cl2N2O2 — CID 171283674
2,3-dibromo-6-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride (PubChem CID 171283674) has the molecular formula C14H20Br2Cl2N2O2 and a molecular weight of 479.04 g/mol. Its IUPAC name is 2,3-dibromo-6-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride.
| Compound Name | 2,3-dibromo-6-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171283674 |
| Molecular Formula | C14H20Br2Cl2N2O2 |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 475.93 |
| IUPAC Name | 2,3-dibromo-6-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride |
| SMILES | C=C[C@@H](c1cc(OC)c(O)c(Br)c1Br)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H18Br2N2O2.2ClH/c1-3-10(18-6-4-17-5-7-18)9-8-11(20-2)14(19)13(16)12(9)15;;/h3,8,10,17,19H,1,4-7H2,2H3;2*1H/t10-;;/m0../s1 |
| InChIKey | FNXJIBXRXBQMKI-XRIOVQLTSA-N |
| XLogP | 3.90 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|