C16H24Br2Cl2N2O2 — CID 171296326
2,3-dibromo-6-methoxy-4-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride (PubChem CID 171296326) has the molecular formula C16H24Br2Cl2N2O2 and a molecular weight of 507.09 g/mol. Its IUPAC name is 2,3-dibromo-6-methoxy-4-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride.
| Compound Name | 2,3-dibromo-6-methoxy-4-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171296326 |
| Molecular Formula | C16H24Br2Cl2N2O2 |
| Molecular Weight | 507.09 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | 2,3-dibromo-6-methoxy-4-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
| SMILES | C=C(C)C[C@H](c1cc(OC)c(O)c(Br)c1Br)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H22Br2N2O2.2ClH/c1-10(2)8-12(20-6-4-19-5-7-20)11-9-13(22-3)16(21)15(18)14(11)17;;/h9,12,19,21H,1,4-8H2,2-3H3;2*1H/t12-;;/m1../s1 |
| InChIKey | ODEJNDDUGBZHPD-CURYUGHLSA-N |
| XLogP | 4.68 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.09 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|