C17H25BrN2O2 — CID 171275617
1-[(1S)-1-(4-bromo-3,5-dimethoxyphenyl)-3-methylbut-3-enyl]piperazine (PubChem CID 171275617) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromo-3,5-dimethoxyphenyl)-3-methylbut-3-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(4-bromo-3,5-dimethoxyphenyl)-3-methylbut-3-enyl]piperazine |
|---|---|
| PubChem CID | 171275617 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[(1S)-1-(4-bromo-3,5-dimethoxyphenyl)-3-methylbut-3-enyl]piperazine |
| SMILES | C=C(C)C[C@@H](c1cc(OC)c(Br)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C17H25BrN2O2/c1-12(2)9-14(20-7-5-19-6-8-20)13-10-15(21-3)17(18)16(11-13)22-4/h10-11,14,19H,1,5-9H2,2-4H3/t14-/m0/s1 |
| InChIKey | ZDZNAWBLGPZVNM-AWEZNQCLSA-N |
| XLogP | 3.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|