C18H28N2O3 — CID 171286282
1-[(1R)-3-methyl-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine (PubChem CID 171286282) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-[(1R)-3-methyl-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine.
| Compound Name | 1-[(1R)-3-methyl-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine |
|---|---|
| PubChem CID | 171286282 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-[(1R)-3-methyl-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine |
| SMILES | C=C(C)C[C@H](c1cc(OC)c(OC)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C18H28N2O3/c1-13(2)10-15(20-8-6-19-7-9-20)14-11-16(21-3)18(23-5)17(12-14)22-4/h11-12,15,19H,1,6-10H2,2-5H3/t15-/m1/s1 |
| InChIKey | PVRZAXRITBERCU-OAHLLOKOSA-N |
| XLogP | 2.62 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|