C19H32N2O3 — CID 171310677
1-[(1R)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentyl]piperazine (PubChem CID 171310677) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(1R)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentyl]piperazine.
| Compound Name | 1-[(1R)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 171310677 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 1-[(1R)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentyl]piperazine |
| SMILES | COc1cc([C@@H](CCC(C)C)N2CCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H32N2O3/c1-14(2)6-7-16(21-10-8-20-9-11-21)15-12-17(22-3)19(24-5)18(13-15)23-4/h12-14,16,20H,6-11H2,1-5H3/t16-/m1/s1 |
| InChIKey | XODAKBRDDLYTOM-MRXNPFEDSA-N |
| XLogP | 3.09 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |