C19H32Cl2N2O3 — CID 171310370
[2-methoxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride (PubChem CID 171310370) has the molecular formula C19H32Cl2N2O3 and a molecular weight of 407.38 g/mol. Its IUPAC name is [2-methoxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride.
| Compound Name | [2-methoxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171310370 |
| Molecular Formula | C19H32Cl2N2O3 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [2-methoxy-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenyl] acetate;dihydrochloride |
| SMILES | COc1cc([C@H](CCC(C)C)N2CCNCC2)ccc1OC(C)=O.Cl.Cl |
| InChI | InChI=1S/C19H30N2O3.2ClH/c1-14(2)5-7-17(21-11-9-20-10-12-21)16-6-8-18(24-15(3)22)19(13-16)23-4;;/h6,8,13-14,17,20H,5,7,9-12H2,1-4H3;2*1H/t17-;;/m0../s1 |
| InChIKey | XJYCLPZTABYCNM-RMRYJAPISA-N |
| XLogP | 3.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|