C17H26N2O3 — CID 171280951
[2-methoxy-4-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate (PubChem CID 171280951) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [2-methoxy-4-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate |
|---|---|
| PubChem CID | 171280951 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [2-methoxy-4-[(1S)-1-piperazin-1-ylbutyl]phenyl] acetate |
| SMILES | CCC[C@@H](c1ccc(OC(C)=O)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-5-15(19-10-8-18-9-11-19)14-6-7-16(22-13(2)20)17(12-14)21-3/h6-7,12,15,18H,4-5,8-11H2,1-3H3/t15-/m0/s1 |
| InChIKey | SYLYPNXGHKLFPD-HNNXBMFYSA-N |
| XLogP | 2.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|